C28H31N3O2 — CID 46700155
N-benzyl-2-[4-(3,3-diphenylpropanoyl)piperazin-1-yl]acetamide (PubChem CID 46700155) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-benzyl-2-[4-(3,3-diphenylpropanoyl)piperazin-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-(3,3-diphenylpropanoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46700155 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-benzyl-2-[4-(3,3-diphenylpropanoyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)CC(c2ccccc2)c2ccccc2)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C28H31N3O2/c32-27(29-21-23-10-4-1-5-11-23)22-30-16-18-31(19-17-30)28(33)20-26(24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-15,26H,16-22H2,(H,29,32) |
| InChIKey | XTNYWUPFYRVBMH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |