C28H31N3O3 — CID 25377837
1-[2-[[(1R)-1,2-diphenylethyl]amino]-2-oxoethyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 25377837) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 1-[2-[[(1R)-1,2-diphenylethyl]amino]-2-oxoethyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[[(1R)-1,2-diphenylethyl]amino]-2-oxoethyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25377837 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 1-[2-[[(1R)-1,2-diphenylethyl]amino]-2-oxoethyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(CN1CCC(C(=O)Nc2ccccc2O)CC1)N[C@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31N3O3/c32-26-14-8-7-13-24(26)30-28(34)23-15-17-31(18-16-23)20-27(33)29-25(22-11-5-2-6-12-22)19-21-9-3-1-4-10-21/h1-14,23,25,32H,15-20H2,(H,29,33)(H,30,34)/t25-/m1/s1 |
| InChIKey | PHGDKKCGIQCKKC-RUZDIDTESA-N |
| XLogP | 4.14 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|