C24H29N3O3 — CID 41099612
N-(2-hydroxyphenyl)-1-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]piperidine-4-carboxamide (PubChem CID 41099612) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-1-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]piperidine-4-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-1-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41099612 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-(2-hydroxyphenyl)-1-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1CCN([C@@H](C(=O)N2CCCC2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3O3/c28-21-11-5-4-10-20(21)25-23(29)19-12-16-26(17-13-19)22(18-8-2-1-3-9-18)24(30)27-14-6-7-15-27/h1-5,8-11,19,22,28H,6-7,12-17H2,(H,25,29)/t22-/m1/s1 |
| InChIKey | YLHZQUDGBCWUFU-JOCHJYFZSA-N |
| XLogP | 3.41 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|