C24H29N3O3 — CID 26385714
1-[(2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 26385714) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-[(2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26385714 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-[(2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | C[C@@H](C(=O)N1CCCc2ccccc21)N1CCC(C(=O)Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C24H29N3O3/c1-17(24(30)27-14-6-8-18-7-2-4-10-21(18)27)26-15-12-19(13-16-26)23(29)25-20-9-3-5-11-22(20)28/h2-5,7,9-11,17,19,28H,6,8,12-16H2,1H3,(H,25,29)/t17-/m0/s1 |
| InChIKey | ORZAHIHXWILKII-KRWDZBQOSA-N |
| XLogP | 3.41 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|