C21H23Cl2N3O3 — CID 60511834
N-(5-chloro-2-hydroxyphenyl)-1-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 60511834) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60511834 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | O=C(CN1CCC(C(=O)Nc2cc(Cl)ccc2O)CC1)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H23Cl2N3O3/c22-16-3-1-2-14(10-16)12-24-20(28)13-26-8-6-15(7-9-26)21(29)25-18-11-17(23)4-5-19(18)27/h1-5,10-11,15,27H,6-9,12-13H2,(H,24,28)(H,25,29) |
| InChIKey | NJGQBBRZZZXFFF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|