C23H32ClN3O3 — CID 112841790
1-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-N-(5-chloro-2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 112841790) has the molecular formula C23H32ClN3O3 and a molecular weight of 433.98 g/mol. Its IUPAC name is 1-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-N-(5-chloro-2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-N-(5-chloro-2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 112841790 |
| Molecular Formula | C23H32ClN3O3 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-N-(5-chloro-2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)C1CCN(CC(=O)N2CCCC3CCCCC32)CC1 |
| InChI | InChI=1S/C23H32ClN3O3/c24-18-7-8-21(28)19(14-18)25-23(30)17-9-12-26(13-10-17)15-22(29)27-11-3-5-16-4-1-2-6-20(16)27/h7-8,14,16-17,20,28H,1-6,9-13,15H2,(H,25,30) |
| InChIKey | PIXBDQIMXKYEAP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|