C22H30ClN3O4 — CID 95787732
1-[(3S)-1-butanoylpiperidine-3-carbonyl]-N-(5-chloro-2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 95787732) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is 1-[(3S)-1-butanoylpiperidine-3-carbonyl]-N-(5-chloro-2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3S)-1-butanoylpiperidine-3-carbonyl]-N-(5-chloro-2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 95787732 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 1-[(3S)-1-butanoylpiperidine-3-carbonyl]-N-(5-chloro-2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | CCCC(=O)N1CCC[C@H](C(=O)N2CCC(C(=O)Nc3cc(Cl)ccc3O)CC2)C1 |
| InChI | InChI=1S/C22H30ClN3O4/c1-2-4-20(28)26-10-3-5-16(14-26)22(30)25-11-8-15(9-12-25)21(29)24-18-13-17(23)6-7-19(18)27/h6-7,13,15-16,27H,2-5,8-12,14H2,1H3,(H,24,29)/t16-/m0/s1 |
| InChIKey | YGMBUGBVGBKRPX-INIZCTEOSA-N |
| XLogP | 3.26 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|