C19H21ClN2O3S — CID 71864229
N-(5-chloro-2-hydroxyphenyl)-1-(2,5-dimethylthiophene-3-carbonyl)piperidine-4-carboxamide (PubChem CID 71864229) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-(2,5-dimethylthiophene-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-(2,5-dimethylthiophene-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71864229 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-(2,5-dimethylthiophene-3-carbonyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCC(C(=O)Nc3cc(Cl)ccc3O)CC2)c(C)s1 |
| InChI | InChI=1S/C19H21ClN2O3S/c1-11-9-15(12(2)26-11)19(25)22-7-5-13(6-8-22)18(24)21-16-10-14(20)3-4-17(16)23/h3-4,9-10,13,23H,5-8H2,1-2H3,(H,21,24) |
| InChIKey | RTYWIZQAFWWUAB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|