C20H29ClN4O4 — CID 52510961
4-N-(5-chloro-2-hydroxyphenyl)-1-N-[(2S)-2-morpholin-4-ylpropyl]piperidine-1,4-dicarboxamide (PubChem CID 52510961) has the molecular formula C20H29ClN4O4 and a molecular weight of 424.93 g/mol. Its IUPAC name is 4-N-(5-chloro-2-hydroxyphenyl)-1-N-[(2S)-2-morpholin-4-ylpropyl]piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(5-chloro-2-hydroxyphenyl)-1-N-[(2S)-2-morpholin-4-ylpropyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 52510961 |
| Molecular Formula | C20H29ClN4O4 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-N-(5-chloro-2-hydroxyphenyl)-1-N-[(2S)-2-morpholin-4-ylpropyl]piperidine-1,4-dicarboxamide |
| SMILES | C[C@@H](CNC(=O)N1CCC(C(=O)Nc2cc(Cl)ccc2O)CC1)N1CCOCC1 |
| InChI | InChI=1S/C20H29ClN4O4/c1-14(24-8-10-29-11-9-24)13-22-20(28)25-6-4-15(5-7-25)19(27)23-17-12-16(21)2-3-18(17)26/h2-3,12,14-15,26H,4-11,13H2,1H3,(H,22,28)(H,23,27)/t14-/m0/s1 |
| InChIKey | WERWDCFDTXBAJZ-AWEZNQCLSA-N |
| XLogP | 2.13 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|