C26H34N4O4 — CID 17486442
4-N-(2-hydroxyphenyl)-1-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]piperidine-1,4-dicarboxamide (PubChem CID 17486442) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 4-N-(2-hydroxyphenyl)-1-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(2-hydroxyphenyl)-1-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 17486442 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 4-N-(2-hydroxyphenyl)-1-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]piperidine-1,4-dicarboxamide |
| SMILES | COc1ccc(C(CNC(=O)N2CCC(C(=O)Nc3ccccc3O)CC2)N2CCCC2)cc1 |
| InChI | InChI=1S/C26H34N4O4/c1-34-21-10-8-19(9-11-21)23(29-14-4-5-15-29)18-27-26(33)30-16-12-20(13-17-30)25(32)28-22-6-2-3-7-24(22)31/h2-3,6-11,20,23,31H,4-5,12-18H2,1H3,(H,27,33)(H,28,32) |
| InChIKey | BHIAPXVDXMYEAZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|