C24H29N3O5 — CID 42920354
1-[3-acetamido-3-(4-methoxyphenyl)propanoyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 42920354) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is 1-[3-acetamido-3-(4-methoxyphenyl)propanoyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-acetamido-3-(4-methoxyphenyl)propanoyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42920354 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 1-[3-acetamido-3-(4-methoxyphenyl)propanoyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(C(CC(=O)N2CCC(C(=O)Nc3ccccc3O)CC2)NC(C)=O)cc1 |
| InChI | InChI=1S/C24H29N3O5/c1-16(28)25-21(17-7-9-19(32-2)10-8-17)15-23(30)27-13-11-18(12-14-27)24(31)26-20-5-3-4-6-22(20)29/h3-10,18,21,29H,11-15H2,1-2H3,(H,25,28)(H,26,31) |
| InChIKey | GNPLXZVMKYGCMI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|