C15H17ClN2O6 — CID 162792957
2-[2-[3-[(5-chloro-2-hydroxyphenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethoxy]acetic acid (PubChem CID 162792957) has the molecular formula C15H17ClN2O6 and a molecular weight of 356.76 g/mol. Its IUPAC name is 2-[2-[3-[(5-chloro-2-hydroxyphenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[3-[(5-chloro-2-hydroxyphenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 162792957 |
| Molecular Formula | C15H17ClN2O6 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-[2-[3-[(5-chloro-2-hydroxyphenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)N1CCC(C(=O)Nc2cc(Cl)ccc2O)C1 |
| InChI | InChI=1S/C15H17ClN2O6/c16-10-1-2-12(19)11(5-10)17-15(23)9-3-4-18(6-9)13(20)7-24-8-14(21)22/h1-2,5,9,19H,3-4,6-8H2,(H,17,23)(H,21,22) |
| InChIKey | WUDOUVDVGGAZOQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|