C22H22ClN3O4 — CID 154749753
N-(5-chloro-2-hydroxyphenyl)-1-(6-methoxy-1H-indole-2-carbonyl)piperidine-4-carboxamide (PubChem CID 154749753) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-(6-methoxy-1H-indole-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-(6-methoxy-1H-indole-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 154749753 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-(6-methoxy-1H-indole-2-carbonyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2cc(C(=O)N3CCC(C(=O)Nc4cc(Cl)ccc4O)CC3)[nH]c2c1 |
| InChI | InChI=1S/C22H22ClN3O4/c1-30-16-4-2-14-10-19(24-17(14)12-16)22(29)26-8-6-13(7-9-26)21(28)25-18-11-15(23)3-5-20(18)27/h2-5,10-13,24,27H,6-9H2,1H3,(H,25,28) |
| InChIKey | LKRIOQQLOZZGAQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|