C21H29ClN2O2 — CID 109150231
4-(azepane-1-carbonyl)-N-(4-chloro-2-methylphenyl)cyclohexane-1-carboxamide (PubChem CID 109150231) has the molecular formula C21H29ClN2O2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 4-(azepane-1-carbonyl)-N-(4-chloro-2-methylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(azepane-1-carbonyl)-N-(4-chloro-2-methylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109150231 |
| Molecular Formula | C21H29ClN2O2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-(azepane-1-carbonyl)-N-(4-chloro-2-methylphenyl)cyclohexane-1-carboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C1CCC(C(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C21H29ClN2O2/c1-15-14-18(22)10-11-19(15)23-20(25)16-6-8-17(9-7-16)21(26)24-12-4-2-3-5-13-24/h10-11,14,16-17H,2-9,12-13H2,1H3,(H,23,25) |
| InChIKey | OCLFFRBQHFWXSN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |