C19H25ClN2O2 — CID 109145686
N-(5-chloro-2-methylphenyl)-4-(pyrrolidine-1-carbonyl)cyclohexane-1-carboxamide (PubChem CID 109145686) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-4-(pyrrolidine-1-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-4-(pyrrolidine-1-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109145686 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-4-(pyrrolidine-1-carbonyl)cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C1CCC(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C19H25ClN2O2/c1-13-4-9-16(20)12-17(13)21-18(23)14-5-7-15(8-6-14)19(24)22-10-2-3-11-22/h4,9,12,14-15H,2-3,5-8,10-11H2,1H3,(H,21,23) |
| InChIKey | LVOSVFCKPCHAPO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |