C14H19ClN2O — CID 54928602
4-amino-N-(5-chloro-2-methylphenyl)cyclohexane-1-carboxamide (PubChem CID 54928602) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 4-amino-N-(5-chloro-2-methylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-(5-chloro-2-methylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 54928602 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-amino-N-(5-chloro-2-methylphenyl)cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C1CCC(N)CC1 |
| InChI | InChI=1S/C14H19ClN2O/c1-9-2-5-11(15)8-13(9)17-14(18)10-3-6-12(16)7-4-10/h2,5,8,10,12H,3-4,6-7,16H2,1H3,(H,17,18) |
| InChIKey | GBSHVXGWMPEOAD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |