C23H27ClN2O2 — CID 109148994
4-N-(5-chloro-2-methylphenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109148994) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is 4-N-(5-chloro-2-methylphenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(5-chloro-2-methylphenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109148994 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-N-(5-chloro-2-methylphenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C1CCC(C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27ClN2O2/c1-16-7-12-20(24)15-21(16)26-23(28)19-10-8-18(9-11-19)22(27)25-14-13-17-5-3-2-4-6-17/h2-7,12,15,18-19H,8-11,13-14H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | BAEBLXQIAGSODB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |