C22H25ClN2O2 — CID 109147946
1-N-benzyl-4-N-(5-chloro-2-methylphenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109147946) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 1-N-benzyl-4-N-(5-chloro-2-methylphenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-benzyl-4-N-(5-chloro-2-methylphenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109147946 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-N-benzyl-4-N-(5-chloro-2-methylphenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C1CCC(C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25ClN2O2/c1-15-7-12-19(23)13-20(15)25-22(27)18-10-8-17(9-11-18)21(26)24-14-16-5-3-2-4-6-16/h2-7,12-13,17-18H,8-11,14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | FHUPSLMARCAQDN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |