C14H17ClN2O2 — CID 112998029
N-[2-(5-chloro-2-methylanilino)-2-oxoethyl]cyclobutanecarboxamide (PubChem CID 112998029) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is N-[2-(5-chloro-2-methylanilino)-2-oxoethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-(5-chloro-2-methylanilino)-2-oxoethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 112998029 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-[2-(5-chloro-2-methylanilino)-2-oxoethyl]cyclobutanecarboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CNC(=O)C1CCC1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-9-5-6-11(15)7-12(9)17-13(18)8-16-14(19)10-3-2-4-10/h5-7,10H,2-4,8H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | PIHCTJOQWGWZPS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |