C23H28N2O2 — CID 109148972
4-N-(3-methylphenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109148972) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-N-(3-methylphenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3-methylphenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109148972 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-N-(3-methylphenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2CCC(C(=O)NCCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H28N2O2/c1-17-6-5-9-21(16-17)25-23(27)20-12-10-19(11-13-20)22(26)24-15-14-18-7-3-2-4-8-18/h2-9,16,19-20H,10-15H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | RMMIJENVSKMUJR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |