C22H24F2N2O2 — CID 109149008
4-N-(2,4-difluorophenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109149008) has the molecular formula C22H24F2N2O2 and a molecular weight of 386.44 g/mol. Its IUPAC name is 4-N-(2,4-difluorophenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(2,4-difluorophenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149008 |
| Molecular Formula | C22H24F2N2O2 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-N-(2,4-difluorophenyl)-1-N-(2-phenylethyl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CCC(C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C22H24F2N2O2/c23-18-10-11-20(19(24)14-18)26-22(28)17-8-6-16(7-9-17)21(27)25-13-12-15-4-2-1-3-5-15/h1-5,10-11,14,16-17H,6-9,12-13H2,(H,25,27)(H,26,28) |
| InChIKey | GZSXTWWEXJDQRO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |