C23H27FN2O2 — CID 109149531
4-N-(2-fluorophenyl)-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109149531) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is 4-N-(2-fluorophenyl)-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(2-fluorophenyl)-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149531 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 4-N-(2-fluorophenyl)-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCC(C(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C23H27FN2O2/c24-20-10-4-5-11-21(20)26-23(28)19-14-12-18(13-15-19)22(27)25-16-6-9-17-7-2-1-3-8-17/h1-5,7-8,10-11,18-19H,6,9,12-16H2,(H,25,27)(H,26,28) |
| InChIKey | DIYBISPYTATJKR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|