C21H32N2O2 — CID 109149515
4-N-tert-butyl-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109149515) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-N-tert-butyl-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-tert-butyl-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149515 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 4-N-tert-butyl-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)C1CCC(C(=O)NCCCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H32N2O2/c1-21(2,3)23-20(25)18-13-11-17(12-14-18)19(24)22-15-7-10-16-8-5-4-6-9-16/h4-6,8-9,17-18H,7,10-15H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | NBYVWDYLGZEJQE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|