C22H28N2O3 — CID 109147782
4-N-(furan-2-ylmethyl)-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109147782) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 4-N-(furan-2-ylmethyl)-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(furan-2-ylmethyl)-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109147782 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 4-N-(furan-2-ylmethyl)-1-N-(3-phenylpropyl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCC(C(=O)NCc2ccco2)CC1 |
| InChI | InChI=1S/C22H28N2O3/c25-21(23-14-4-8-17-6-2-1-3-7-17)18-10-12-19(13-11-18)22(26)24-16-20-9-5-15-27-20/h1-3,5-7,9,15,18-19H,4,8,10-14,16H2,(H,23,25)(H,24,26) |
| InChIKey | PBYXYERWPWEUOP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|