C12H17NO2 — CID 110733508
N-[2-(furan-2-yl)ethyl]cyclopentanecarboxamide (PubChem CID 110733508) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 110733508 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]cyclopentanecarboxamide |
| SMILES | O=C(NCCc1ccco1)C1CCCC1 |
| InChI | InChI=1S/C12H17NO2/c14-12(10-4-1-2-5-10)13-8-7-11-6-3-9-15-11/h3,6,9-10H,1-2,4-5,7-8H2,(H,13,14) |
| InChIKey | QMCWYDUNIFJKFY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |