C18H22N2O4S — CID 17442188
1-(benzenesulfonyl)-N-[2-(furan-2-yl)ethyl]piperidine-4-carboxamide (PubChem CID 17442188) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-(furan-2-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-(furan-2-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17442188 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-(furan-2-yl)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCc1ccco1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H22N2O4S/c21-18(19-11-8-16-5-4-14-24-16)15-9-12-20(13-10-15)25(22,23)17-6-2-1-3-7-17/h1-7,14-15H,8-13H2,(H,19,21) |
| InChIKey | AKZQJKCMAWPBQI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |