C20H18F4N2O2 — CID 26722049
1-N,4-N-bis(2,4-difluorophenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 26722049) has the molecular formula C20H18F4N2O2 and a molecular weight of 394.37 g/mol. Its IUPAC name is 1-N,4-N-bis(2,4-difluorophenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(2,4-difluorophenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 26722049 |
| Molecular Formula | C20H18F4N2O2 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-N,4-N-bis(2,4-difluorophenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1CCC(C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C20H18F4N2O2/c21-13-5-7-17(15(23)9-13)25-19(27)11-1-2-12(4-3-11)20(28)26-18-8-6-14(22)10-16(18)24/h5-12H,1-4H2,(H,25,27)(H,26,28) |
| InChIKey | ABJVTSGBOOZJSW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |