C19H23F2N3O3 — CID 109147669
N-(2,4-difluorophenyl)-4-(4-formylpiperazine-1-carbonyl)cyclohexane-1-carboxamide (PubChem CID 109147669) has the molecular formula C19H23F2N3O3 and a molecular weight of 379.41 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(4-formylpiperazine-1-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(4-formylpiperazine-1-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109147669 |
| Molecular Formula | C19H23F2N3O3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(4-formylpiperazine-1-carbonyl)cyclohexane-1-carboxamide |
| SMILES | O=CN1CCN(C(=O)C2CCC(C(=O)Nc3ccc(F)cc3F)CC2)CC1 |
| InChI | InChI=1S/C19H23F2N3O3/c20-15-5-6-17(16(21)11-15)22-18(26)13-1-3-14(4-2-13)19(27)24-9-7-23(12-25)8-10-24/h5-6,11-14H,1-4,7-10H2,(H,22,26) |
| InChIKey | MBWASVBXUCLCHV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|