C21H29N3O4 — CID 136516101
1-(1-butanoylpyrrolidine-2-carbonyl)-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 136516101) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-(1-butanoylpyrrolidine-2-carbonyl)-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(1-butanoylpyrrolidine-2-carbonyl)-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 136516101 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-(1-butanoylpyrrolidine-2-carbonyl)-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | CCCC(=O)N1CCCC1C(=O)N1CCC(C(=O)Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C21H29N3O4/c1-2-6-19(26)24-12-5-8-17(24)21(28)23-13-10-15(11-14-23)20(27)22-16-7-3-4-9-18(16)25/h3-4,7,9,15,17,25H,2,5-6,8,10-14H2,1H3,(H,22,27) |
| InChIKey | GQUUNRIMCUWCTR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|