C25H33N3O2 — CID 55683199
4-N-(1,2-diphenylethyl)-1-N,1-N-diethylpiperidine-1,4-dicarboxamide (PubChem CID 55683199) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-N-(1,2-diphenylethyl)-1-N,1-N-diethylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(1,2-diphenylethyl)-1-N,1-N-diethylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 55683199 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 4-N-(1,2-diphenylethyl)-1-N,1-N-diethylpiperidine-1,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(C(=O)NC(Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H33N3O2/c1-3-27(4-2)25(30)28-17-15-22(16-18-28)24(29)26-23(21-13-9-6-10-14-21)19-20-11-7-5-8-12-20/h5-14,22-23H,3-4,15-19H2,1-2H3,(H,26,29) |
| InChIKey | FGJPDBVJAZRNLD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |