C24H30N2O2 — CID 113002830
N-butan-2-yl-1-(2,2-diphenylacetyl)piperidine-4-carboxamide (PubChem CID 113002830) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-butan-2-yl-1-(2,2-diphenylacetyl)piperidine-4-carboxamide.
| Compound Name | N-butan-2-yl-1-(2,2-diphenylacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113002830 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-butan-2-yl-1-(2,2-diphenylacetyl)piperidine-4-carboxamide |
| SMILES | CCC(C)NC(=O)C1CCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c1-3-18(2)25-23(27)21-14-16-26(17-15-21)24(28)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,18,21-22H,3,14-17H2,1-2H3,(H,25,27) |
| InChIKey | YCQLUUAQMVJLAT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |