C21H27ClN2O — CID 119519475
1-[4-(1-aminoethyl)piperidin-1-yl]-2,2-diphenylethanone;hydrochloride (PubChem CID 119519475) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 1-[4-(1-aminoethyl)piperidin-1-yl]-2,2-diphenylethanone;hydrochloride.
| Compound Name | 1-[4-(1-aminoethyl)piperidin-1-yl]-2,2-diphenylethanone;hydrochloride |
|---|---|
| PubChem CID | 119519475 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-[4-(1-aminoethyl)piperidin-1-yl]-2,2-diphenylethanone;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)C(c2ccccc2)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C21H26N2O.ClH/c1-16(22)17-12-14-23(15-13-17)21(24)20(18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,16-17,20H,12-15,22H2,1H3;1H |
| InChIKey | PTPMCJQKANAYRM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |