C25H32N2O2 — CID 108555568
N-[1-(2,2-diphenylacetyl)piperidin-4-yl]-2-ethylbutanamide (PubChem CID 108555568) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-[1-(2,2-diphenylacetyl)piperidin-4-yl]-2-ethylbutanamide.
| Compound Name | N-[1-(2,2-diphenylacetyl)piperidin-4-yl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 108555568 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-[1-(2,2-diphenylacetyl)piperidin-4-yl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NC1CCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N2O2/c1-3-19(4-2)24(28)26-22-15-17-27(18-16-22)25(29)23(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22-23H,3-4,15-18H2,1-2H3,(H,26,28) |
| InChIKey | IWNCFMZAKRJYEY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |