C16H23N3O2 — CID 61163953
N-[1-[(2R)-2-amino-2-phenylacetyl]piperidin-4-yl]propanamide (PubChem CID 61163953) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[1-[(2R)-2-amino-2-phenylacetyl]piperidin-4-yl]propanamide.
| Compound Name | N-[1-[(2R)-2-amino-2-phenylacetyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 61163953 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[1-[(2R)-2-amino-2-phenylacetyl]piperidin-4-yl]propanamide |
| SMILES | CCC(=O)NC1CCN(C(=O)[C@H](N)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-14(20)18-13-8-10-19(11-9-13)16(21)15(17)12-6-4-3-5-7-12/h3-7,13,15H,2,8-11,17H2,1H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | PAABFVKRXFMKQD-OAHLLOKOSA-N |
| XLogP | 1.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |