C16H24N4O2 — CID 56867282
4-[[(2R)-2-amino-2-phenylacetyl]amino]-N-ethylpiperidine-1-carboxamide (PubChem CID 56867282) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[[(2R)-2-amino-2-phenylacetyl]amino]-N-ethylpiperidine-1-carboxamide.
| Compound Name | 4-[[(2R)-2-amino-2-phenylacetyl]amino]-N-ethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 56867282 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 4-[[(2R)-2-amino-2-phenylacetyl]amino]-N-ethylpiperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC(NC(=O)[C@H](N)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-2-18-16(22)20-10-8-13(9-11-20)19-15(21)14(17)12-6-4-3-5-7-12/h3-7,13-14H,2,8-11,17H2,1H3,(H,18,22)(H,19,21)/t14-/m1/s1 |
| InChIKey | YPJYNKVFLGBEPA-CQSZACIVSA-N |
| XLogP | 1.00 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |