C22H34ClN3O3 — CID 120791093
2-amino-2-(oxan-4-yl)-N-[1-(2-phenylbutanoyl)piperidin-4-yl]acetamide;hydrochloride (PubChem CID 120791093) has the molecular formula C22H34ClN3O3 and a molecular weight of 423.99 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-[1-(2-phenylbutanoyl)piperidin-4-yl]acetamide;hydrochloride.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-[1-(2-phenylbutanoyl)piperidin-4-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120791093 |
| Molecular Formula | C22H34ClN3O3 |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-[1-(2-phenylbutanoyl)piperidin-4-yl]acetamide;hydrochloride |
| SMILES | CCC(C(=O)N1CCC(NC(=O)C(N)C2CCOCC2)CC1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H33N3O3.ClH/c1-2-19(16-6-4-3-5-7-16)22(27)25-12-8-18(9-13-25)24-21(26)20(23)17-10-14-28-15-11-17;/h3-7,17-20H,2,8-15,23H2,1H3,(H,24,26);1H |
| InChIKey | HKFYEDCPWYLCRO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |