C21H32ClN3O2 — CID 119763637
3-amino-N-[1-(2-phenylbutanoyl)piperidin-4-yl]cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119763637) has the molecular formula C21H32ClN3O2 and a molecular weight of 393.96 g/mol. Its IUPAC name is 3-amino-N-[1-(2-phenylbutanoyl)piperidin-4-yl]cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[1-(2-phenylbutanoyl)piperidin-4-yl]cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119763637 |
| Molecular Formula | C21H32ClN3O2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-amino-N-[1-(2-phenylbutanoyl)piperidin-4-yl]cyclopentane-1-carboxamide;hydrochloride |
| SMILES | CCC(C(=O)N1CCC(NC(=O)C2CCC(N)C2)CC1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H31N3O2.ClH/c1-2-19(15-6-4-3-5-7-15)21(26)24-12-10-18(11-13-24)23-20(25)16-8-9-17(22)14-16;/h3-7,16-19H,2,8-14,22H2,1H3,(H,23,25);1H |
| InChIKey | HWVAYLIFRKQMQA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |