C24H30N2O3 — CID 108563754
butyl N-[1-(2,2-diphenylacetyl)piperidin-4-yl]carbamate (PubChem CID 108563754) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is butyl N-[1-(2,2-diphenylacetyl)piperidin-4-yl]carbamate.
| Compound Name | butyl N-[1-(2,2-diphenylacetyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108563754 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | butyl N-[1-(2,2-diphenylacetyl)piperidin-4-yl]carbamate |
| SMILES | CCCCOC(=O)NC1CCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O3/c1-2-3-18-29-24(28)25-21-14-16-26(17-15-21)23(27)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,21-22H,2-3,14-18H2,1H3,(H,25,28) |
| InChIKey | IISGRKFFFZZLLT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|