C27H41N3O7 — CID 66854406
tert-butyl 5-[4-(butoxycarbonylamino)piperidin-1-yl]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 66854406) has the molecular formula C27H41N3O7 and a molecular weight of 519.64 g/mol. Its IUPAC name is tert-butyl 5-[4-(butoxycarbonylamino)piperidin-1-yl]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl 5-[4-(butoxycarbonylamino)piperidin-1-yl]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 66854406 |
| Molecular Formula | C27H41N3O7 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | tert-butyl 5-[4-(butoxycarbonylamino)piperidin-1-yl]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCCCOC(=O)NC1CCN(C(=O)C(CCC(=O)OC(C)(C)C)NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H41N3O7/c1-5-6-18-35-25(33)28-21-14-16-30(17-15-21)24(32)22(12-13-23(31)37-27(2,3)4)29-26(34)36-19-20-10-8-7-9-11-20/h7-11,21-22H,5-6,12-19H2,1-4H3,(H,28,33)(H,29,34) |
| InChIKey | JLCURXZWMCXZPA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|