C23H35N3O6 — CID 67469833
5-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 67469833) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is 5-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 67469833 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 5-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCCCC(NC(=O)OCc2ccccc2)C(=O)O)CC1 |
| InChI | InChI=1S/C23H35N3O6/c1-23(2,3)32-22(30)26-14-11-18(12-15-26)24-13-7-10-19(20(27)28)25-21(29)31-16-17-8-5-4-6-9-17/h4-6,8-9,18-19,24H,7,10-16H2,1-3H3,(H,25,29)(H,27,28) |
| InChIKey | GRZPIWIVTZVABK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|