C23H36N4O4 — CID 167091282
tert-butyl 3-[4-[2-(phenylmethoxycarbonylamino)ethylamino]piperidin-1-yl]azetidine-1-carboxylate (PubChem CID 167091282) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-(phenylmethoxycarbonylamino)ethylamino]piperidin-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[2-(phenylmethoxycarbonylamino)ethylamino]piperidin-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 167091282 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | tert-butyl 3-[4-[2-(phenylmethoxycarbonylamino)ethylamino]piperidin-1-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N2CCC(NCCNC(=O)OCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C23H36N4O4/c1-23(2,3)31-22(29)27-15-20(16-27)26-13-9-19(10-14-26)24-11-12-25-21(28)30-17-18-7-5-4-6-8-18/h4-8,19-20,24H,9-17H2,1-3H3,(H,25,28) |
| InChIKey | QBAKKWKEKVUITM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|