C19H28N2O5 — CID 68809547
tert-butyl 3-hydroxy-4-(phenylmethoxycarbonylaminomethyl)piperidine-1-carboxylate (PubChem CID 68809547) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-4-(phenylmethoxycarbonylaminomethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-4-(phenylmethoxycarbonylaminomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68809547 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | tert-butyl 3-hydroxy-4-(phenylmethoxycarbonylaminomethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)OCc2ccccc2)C(O)C1 |
| InChI | InChI=1S/C19H28N2O5/c1-19(2,3)26-18(24)21-10-9-15(16(22)12-21)11-20-17(23)25-13-14-7-5-4-6-8-14/h4-8,15-16,22H,9-13H2,1-3H3,(H,20,23) |
| InChIKey | ZYMMICKLUJCGIJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |