C20H30N2O4 — CID 137424963
tert-butyl 4-(phenylmethoxycarbonylaminomethyl)azepane-1-carboxylate (PubChem CID 137424963) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl 4-(phenylmethoxycarbonylaminomethyl)azepane-1-carboxylate.
| Compound Name | tert-butyl 4-(phenylmethoxycarbonylaminomethyl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 137424963 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | tert-butyl 4-(phenylmethoxycarbonylaminomethyl)azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N2O4/c1-20(2,3)26-19(24)22-12-7-10-16(11-13-22)14-21-18(23)25-15-17-8-5-4-6-9-17/h4-6,8-9,16H,7,10-15H2,1-3H3,(H,21,23) |
| InChIKey | GPZZFWMMMYPOEY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |