C24H39N3O6Si — CID 140672940
tert-butyl 4-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxycarbonylamino)piperidine-1-carboxylate (PubChem CID 140672940) has the molecular formula C24H39N3O6Si and a molecular weight of 493.68 g/mol. Its IUPAC name is tert-butyl 4-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxycarbonylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxycarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140672940 |
| Molecular Formula | C24H39N3O6Si |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | tert-butyl 4-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxycarbonylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)OCc2ccccc2)C(NC(=O)OCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C24H39N3O6Si/c1-24(2,3)33-23(30)27-13-12-19(25-22(29)32-17-18-10-8-7-9-11-18)20(16-27)26-21(28)31-14-15-34(4,5)6/h7-11,19-20H,12-17H2,1-6H3,(H,25,29)(H,26,28) |
| InChIKey | HDZFLFCCCGWMOD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|