C16H33N3O4Si — CID 66621710
2-trimethylsilylethyl (3R,4S)-4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate (PubChem CID 66621710) has the molecular formula C16H33N3O4Si and a molecular weight of 359.54 g/mol. Its IUPAC name is 2-trimethylsilylethyl (3R,4S)-4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl (3R,4S)-4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66621710 |
| Molecular Formula | C16H33N3O4Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-trimethylsilylethyl (3R,4S)-4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CN(C(=O)OCC[Si](C)(C)C)CC[C@@H]1N |
| InChI | InChI=1S/C16H33N3O4Si/c1-16(2,3)23-14(20)18-13-11-19(8-7-12(13)17)15(21)22-9-10-24(4,5)6/h12-13H,7-11,17H2,1-6H3,(H,18,20)/t12-,13+/m0/s1 |
| InChIKey | JXGPFSAAYYZVLN-QWHCGFSZSA-N |
| XLogP | 2.39 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|