C21H33N3O4 — CID 177028190
benzyl N-[2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]ethyl]carbamate (PubChem CID 177028190) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is benzyl N-[2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 177028190 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | benzyl N-[2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(NCCNC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H33N3O4/c1-21(2,3)28-20(26)24-18-11-9-17(10-12-18)22-13-14-23-19(25)27-15-16-7-5-4-6-8-16/h4-8,17-18,22H,9-15H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | KQGNOVKENMTLHG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|