C21H33N3O4 — CID 146599653
benzyl N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propyl]carbamate (PubChem CID 146599653) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is benzyl N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propyl]carbamate.
| Compound Name | benzyl N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 146599653 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | benzyl N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCCNC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H33N3O4/c1-21(2,3)28-20(26)23-18-10-14-24(15-11-18)13-7-12-22-19(25)27-16-17-8-5-4-6-9-17/h4-6,8-9,18H,7,10-16H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | JQUKJJGVWFTZMM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|