C21H33N5O4 — CID 175151366
benzyl N-[6-amino-1-[4-(methylcarbamoylamino)piperidin-1-yl]-1-oxohexan-2-yl]carbamate (PubChem CID 175151366) has the molecular formula C21H33N5O4 and a molecular weight of 419.53 g/mol. Its IUPAC name is benzyl N-[6-amino-1-[4-(methylcarbamoylamino)piperidin-1-yl]-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[6-amino-1-[4-(methylcarbamoylamino)piperidin-1-yl]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 175151366 |
| Molecular Formula | C21H33N5O4 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | benzyl N-[6-amino-1-[4-(methylcarbamoylamino)piperidin-1-yl]-1-oxohexan-2-yl]carbamate |
| SMILES | CNC(=O)NC1CCN(C(=O)C(CCCCN)NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H33N5O4/c1-23-20(28)24-17-10-13-26(14-11-17)19(27)18(9-5-6-12-22)25-21(29)30-15-16-7-3-2-4-8-16/h2-4,7-8,17-18H,5-6,9-15,22H2,1H3,(H,25,29)(H2,23,24,28) |
| InChIKey | VNVJPKBBTYMNQP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|