C32H45N3O4 — CID 93095595
benzyl N-[(2R)-1-(4-benzylpiperidin-1-yl)-6-(3,3-dimethylbutanoylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 93095595) has the molecular formula C32H45N3O4 and a molecular weight of 535.73 g/mol. Its IUPAC name is benzyl N-[(2R)-1-(4-benzylpiperidin-1-yl)-6-(3,3-dimethylbutanoylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-(4-benzylpiperidin-1-yl)-6-(3,3-dimethylbutanoylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 93095595 |
| Molecular Formula | C32H45N3O4 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.34 |
| IUPAC Name | benzyl N-[(2R)-1-(4-benzylpiperidin-1-yl)-6-(3,3-dimethylbutanoylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)CC(=O)NCCCC[C@@H](NC(=O)OCc1ccccc1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H45N3O4/c1-32(2,3)23-29(36)33-19-11-10-16-28(34-31(38)39-24-27-14-8-5-9-15-27)30(37)35-20-17-26(18-21-35)22-25-12-6-4-7-13-25/h4-9,12-15,26,28H,10-11,16-24H2,1-3H3,(H,33,36)(H,34,38)/t28-/m1/s1 |
| InChIKey | KOGKSPZIMSSLHZ-MUUNZHRXSA-N |
| XLogP | 5.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|