C22H29F2N3O4 — CID 71459383
benzyl N-[(2S)-1-(4,4-difluoropiperidin-1-yl)-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate (PubChem CID 71459383) has the molecular formula C22H29F2N3O4 and a molecular weight of 437.49 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(4,4-difluoropiperidin-1-yl)-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(4,4-difluoropiperidin-1-yl)-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 71459383 |
| Molecular Formula | C22H29F2N3O4 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | benzyl N-[(2S)-1-(4,4-difluoropiperidin-1-yl)-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate |
| SMILES | C=CC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C22H29F2N3O4/c1-2-19(28)25-13-7-6-10-18(20(29)27-14-11-22(23,24)12-15-27)26-21(30)31-16-17-8-4-3-5-9-17/h2-5,8-9,18H,1,6-7,10-16H2,(H,25,28)(H,26,30)/t18-/m0/s1 |
| InChIKey | KUXSHWPWVWCPLO-SFHVURJKSA-N |
| XLogP | 3.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|